About (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione
(5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione (PubChem CID 151668508) has the molecular formula C14H15ClFN3O2
and a molecular weight of 311.74 g/mol. Its IUPAC name is (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione.
Molecular Properties
| Compound Name | (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione |
| PubChem CID | 151668508 |
| Molecular Formula | C14H15ClFN3O2 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione |
| SMILES | CN1C[C@@]2(CCC[C@H](c3nc(Cl)ncc3F)C2)C(=O)C1=O |
| InChI | InChI=1S/C14H15ClFN3O2/c1-19-7-14(11(20)12(19)21)4-2-3-8(5-14)10-9(16)6-17-13(15)18-10/h6,8H,2-5,7H2,1H3/t8-,14-/m0/s1 |
| InChIKey | QYANVWLABVXTOM-RTHLEPHNSA-N |
| XLogP | 1.95 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione?
The IUPAC name of (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione (CID 151668508) is (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione.
What is the SMILES notation for (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione?
The canonical SMILES for (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione is CN1C[C@@]2(CCC[C@H](c3nc(Cl)ncc3F)C2)C(=O)C1=O.
What is the InChIKey of (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione?
The InChIKey is QYANVWLABVXTOM-RTHLEPHNSA-N. The full InChI is InChI=1S/C14H15ClFN3O2/c1-19-7-14(11(20)12(19)21)4-2-3-8(5-14)10-9(16)6-17-13(15)18-10/h6,8H,2-5,7H2,1H3/t8-,14-/m0/s1.
What are the key properties of (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione?
(5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione has a molecular weight of 311.74 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione is sourced from PubChem (CID 151668508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).