C14H15ClFN3O2 — CID 151668508
(5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione (PubChem CID 151668508) has the molecular formula C14H15ClFN3O2 and a molecular weight of 311.74 g/mol. Its IUPAC name is (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione.
| Compound Name | (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione |
|---|---|
| PubChem CID | 151668508 |
| Molecular Formula | C14H15ClFN3O2 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (5S,7S)-7-(2-chloro-5-fluoropyrimidin-4-yl)-2-methyl-2-azaspiro[4.5]decane-3,4-dione |
| SMILES | CN1C[C@@]2(CCC[C@H](c3nc(Cl)ncc3F)C2)C(=O)C1=O |
| InChI | InChI=1S/C14H15ClFN3O2/c1-19-7-14(11(20)12(19)21)4-2-3-8(5-14)10-9(16)6-17-13(15)18-10/h6,8H,2-5,7H2,1H3/t8-,14-/m0/s1 |
| InChIKey | QYANVWLABVXTOM-RTHLEPHNSA-N |
| XLogP | 1.95 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|