C23H32O4 — CID 151668925
2-[[3-(methoxymethoxy)phenyl]-(2-oxocycloheptyl)methyl]cycloheptan-1-one (PubChem CID 151668925) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[[3-(methoxymethoxy)phenyl]-(2-oxocycloheptyl)methyl]cycloheptan-1-one.
| Compound Name | 2-[[3-(methoxymethoxy)phenyl]-(2-oxocycloheptyl)methyl]cycloheptan-1-one |
|---|---|
| PubChem CID | 151668925 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[[3-(methoxymethoxy)phenyl]-(2-oxocycloheptyl)methyl]cycloheptan-1-one |
| SMILES | COCOc1cccc(C(C2CCCCCC2=O)C2CCCCCC2=O)c1 |
| InChI | InChI=1S/C23H32O4/c1-26-16-27-18-10-8-9-17(15-18)23(19-11-4-2-6-13-21(19)24)20-12-5-3-7-14-22(20)25/h8-10,15,19-20,23H,2-7,11-14,16H2,1H3 |
| InChIKey | QYCSYEWHJMLJQZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|