About 8-tert-butylperoxyoctyl octanoate
8-tert-butylperoxyoctyl octanoate (PubChem CID 151668949) has the molecular formula C20H40O4
and a molecular weight of 344.54 g/mol. Its IUPAC name is 8-tert-butylperoxyoctyl octanoate.
Molecular Properties
| Compound Name | 8-tert-butylperoxyoctyl octanoate |
| PubChem CID | 151668949 |
| Molecular Formula | C20H40O4 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 8-tert-butylperoxyoctyl octanoate |
| SMILES | CCCCCCCC(=O)OCCCCCCCCOOC(C)(C)C |
| InChI | InChI=1S/C20H40O4/c1-5-6-7-10-13-16-19(21)22-17-14-11-8-9-12-15-18-23-24-20(2,3)4/h5-18H2,1-4H3 |
| InChIKey | QYCWLKLFYIJKJN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 8-tert-butylperoxyoctyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butylperoxyoctyl octanoate?
The IUPAC name of 8-tert-butylperoxyoctyl octanoate (CID 151668949) is 8-tert-butylperoxyoctyl octanoate.
What is the SMILES notation for 8-tert-butylperoxyoctyl octanoate?
The canonical SMILES for 8-tert-butylperoxyoctyl octanoate is CCCCCCCC(=O)OCCCCCCCCOOC(C)(C)C.
What is the InChIKey of 8-tert-butylperoxyoctyl octanoate?
The InChIKey is QYCWLKLFYIJKJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O4/c1-5-6-7-10-13-16-19(21)22-17-14-11-8-9-12-15-18-23-24-20(2,3)4/h5-18H2,1-4H3.
What are the key properties of 8-tert-butylperoxyoctyl octanoate?
8-tert-butylperoxyoctyl octanoate has a molecular weight of 344.54 g/mol, XLogP of 5.98, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butylperoxyoctyl octanoate is sourced from PubChem (CID 151668949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).