About 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea
1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea (PubChem CID 15167047) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea |
| PubChem CID | 15167047 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)CC#CCN(C)C |
| InChI | InChI=1S/C9H17N3O/c1-10-9(13)12(4)8-6-5-7-11(2)3/h7-8H2,1-4H3,(H,10,13) |
| InChIKey | YNDZUBMXEBSYAC-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea?
The IUPAC name of 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea (CID 15167047) is 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea.
What is the SMILES notation for 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea?
The canonical SMILES for 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea is CNC(=O)N(C)CC#CCN(C)C.
What is the InChIKey of 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea?
The InChIKey is YNDZUBMXEBSYAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-10-9(13)12(4)8-6-5-7-11(2)3/h7-8H2,1-4H3,(H,10,13).
What are the key properties of 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea?
1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea has a molecular weight of 183.25 g/mol, XLogP of -0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(dimethylamino)but-2-ynyl]-1,3-dimethylurea is sourced from PubChem (CID 15167047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).