About 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea
1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea (PubChem CID 15167048) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea |
| PubChem CID | 15167048 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea |
| SMILES | CCN(CC)CC#CCN(C)C(=O)NC |
| InChI | InChI=1S/C11H21N3O/c1-5-14(6-2)10-8-7-9-13(4)11(15)12-3/h5-6,9-10H2,1-4H3,(H,12,15) |
| InChIKey | KYZAHLKFWKCRCF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea?
The IUPAC name of 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea (CID 15167048) is 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea.
What is the SMILES notation for 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea?
The canonical SMILES for 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea is CCN(CC)CC#CCN(C)C(=O)NC.
What is the InChIKey of 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea?
The InChIKey is KYZAHLKFWKCRCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-5-14(6-2)10-8-7-9-13(4)11(15)12-3/h5-6,9-10H2,1-4H3,(H,12,15).
What are the key properties of 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea?
1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea has a molecular weight of 211.31 g/mol, XLogP of 0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(diethylamino)but-2-ynyl]-1,3-dimethylurea is sourced from PubChem (CID 15167048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).