C15H27IO2Si — CID 151673637
tert-butyl-[(2R,3S,6R)-2-[(E)-2-iodoethenyl]-6-methyl-4-methylideneoxan-3-yl]oxy-dimethylsilane (PubChem CID 151673637) has the molecular formula C15H27IO2Si and a molecular weight of 394.37 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,6R)-2-[(E)-2-iodoethenyl]-6-methyl-4-methylideneoxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S,6R)-2-[(E)-2-iodoethenyl]-6-methyl-4-methylideneoxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 151673637 |
| Molecular Formula | C15H27IO2Si |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | tert-butyl-[(2R,3S,6R)-2-[(E)-2-iodoethenyl]-6-methyl-4-methylideneoxan-3-yl]oxy-dimethylsilane |
| SMILES | C=C1C[C@@H](C)O[C@H](/C=C/I)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27IO2Si/c1-11-10-12(2)17-13(8-9-16)14(11)18-19(6,7)15(3,4)5/h8-9,12-14H,1,10H2,2-7H3/b9-8+/t12-,13-,14+/m1/s1 |
| InChIKey | QZBSFJGEENBEGG-TUTKNLRESA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|