About 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole
2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole (PubChem CID 15167621) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole.
Analyze 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole (CID 15167621) is 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole is C1CC2NCCN2C1.
What is the InChIKey of 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole?
The InChIKey is LFVLFBIZLPMDPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-2-6-7-3-5-8(6)4-1/h6-7H,1-5H2.
What are the key properties of 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole?
2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole has a molecular weight of 112.18 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 15167621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).