About N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide
N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide (PubChem CID 15167671) has the molecular formula C18H29N5O5
and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide |
| PubChem CID | 15167671 |
| Molecular Formula | C18H29N5O5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide |
| SMILES | COc1nc(NC(C)=O)nc2ncn(COC(COC(C)C)COC(C)C)c12 |
| InChI | InChI=1S/C18H29N5O5/c1-11(2)26-7-14(8-27-12(3)4)28-10-23-9-19-16-15(23)17(25-6)22-18(21-16)20-13(5)24/h9,11-12,14H,7-8,10H2,1-6H3,(H,20,21,22,24) |
| InChIKey | SLLIWDRZGBIIFT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide?
The IUPAC name of N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide (CID 15167671) is N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide.
What is the SMILES notation for N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide?
The canonical SMILES for N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide is COc1nc(NC(C)=O)nc2ncn(COC(COC(C)C)COC(C)C)c12.
What is the InChIKey of N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide?
The InChIKey is SLLIWDRZGBIIFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N5O5/c1-11(2)26-7-14(8-27-12(3)4)28-10-23-9-19-16-15(23)17(25-6)22-18(21-16)20-13(5)24/h9,11-12,14H,7-8,10H2,1-6H3,(H,20,21,22,24).
What are the key properties of N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide?
N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide has a molecular weight of 395.46 g/mol, XLogP of 1.99, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]-6-methoxypurin-2-yl]acetamide is sourced from PubChem (CID 15167671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).