About 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol
4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol (PubChem CID 151679111) has the molecular formula C12H11ClO2S
and a molecular weight of 254.74 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol.
Molecular Properties
| Compound Name | 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol |
| PubChem CID | 151679111 |
| Molecular Formula | C12H11ClO2S |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol |
| SMILES | Cc1sc(O)c(C)c1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClO2S/c1-7-11(8(2)16-12(7)14)15-10-5-3-9(13)4-6-10/h3-6,14H,1-2H3 |
| InChIKey | RADQBNVWXGGGTG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol?
The IUPAC name of 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol (CID 151679111) is 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol.
What is the SMILES notation for 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol?
The canonical SMILES for 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol is Cc1sc(O)c(C)c1Oc1ccc(Cl)cc1.
What is the InChIKey of 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol?
The InChIKey is RADQBNVWXGGGTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClO2S/c1-7-11(8(2)16-12(7)14)15-10-5-3-9(13)4-6-10/h3-6,14H,1-2H3.
What are the key properties of 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol?
4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol has a molecular weight of 254.74 g/mol, XLogP of 4.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenoxy)-3,5-dimethylthiophen-2-ol is sourced from PubChem (CID 151679111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).