About 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine
2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine (PubChem CID 151679183) has the molecular formula C7H6Cl2F2N2
and a molecular weight of 227.04 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine.
Molecular Properties
| Compound Name | 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine |
| PubChem CID | 151679183 |
| Molecular Formula | C7H6Cl2F2N2 |
| Molecular Weight | 227.04 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine |
| SMILES | FC(F)CNc1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C7H6Cl2F2N2/c8-4-2-13-6(9)1-5(4)12-3-7(10)11/h1-2,7H,3H2,(H,12,13) |
| InChIKey | RAEAXHPDISPCFY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.04 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine?
The IUPAC name of 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine (CID 151679183) is 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine.
What is the SMILES notation for 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine?
The canonical SMILES for 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine is FC(F)CNc1cc(Cl)ncc1Cl.
What is the InChIKey of 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine?
The InChIKey is RAEAXHPDISPCFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2F2N2/c8-4-2-13-6(9)1-5(4)12-3-7(10)11/h1-2,7H,3H2,(H,12,13).
What are the key properties of 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine?
2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine has a molecular weight of 227.04 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-N-(2,2-difluoroethyl)pyridin-4-amine is sourced from PubChem (CID 151679183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).