About 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine
2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine (PubChem CID 151679409) has the molecular formula C10H10BrNO
and a molecular weight of 240.10 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine |
| PubChem CID | 151679409 |
| Molecular Formula | C10H10BrNO |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine |
| SMILES | Brc1cccc(C2NCC=CO2)c1 |
| InChI | InChI=1S/C10H10BrNO/c11-9-4-1-3-8(7-9)10-12-5-2-6-13-10/h1-4,6-7,10,12H,5H2 |
| InChIKey | RAFCWLKVFBSSRZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine?
The IUPAC name of 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine (CID 151679409) is 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine.
What is the SMILES notation for 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine?
The canonical SMILES for 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine is Brc1cccc(C2NCC=CO2)c1.
What is the InChIKey of 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine?
The InChIKey is RAFCWLKVFBSSRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO/c11-9-4-1-3-8(7-9)10-12-5-2-6-13-10/h1-4,6-7,10,12H,5H2.
What are the key properties of 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine?
2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine has a molecular weight of 240.10 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)-3,4-dihydro-2H-1,3-oxazine is sourced from PubChem (CID 151679409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).