About 5-oxo-1,3-oxathiolane-2-carboxylic acid
5-oxo-1,3-oxathiolane-2-carboxylic acid (PubChem CID 15168211) has the molecular formula C4H4O4S
and a molecular weight of 148.14 g/mol. Its IUPAC name is 5-oxo-1,3-oxathiolane-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-oxo-1,3-oxathiolane-2-carboxylic acid |
| PubChem CID | 15168211 |
| Molecular Formula | C4H4O4S |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 147.98 |
| IUPAC Name | 5-oxo-1,3-oxathiolane-2-carboxylic acid |
| SMILES | O=C1CSC(C(=O)O)O1 |
| InChI | InChI=1S/C4H4O4S/c5-2-1-9-4(8-2)3(6)7/h4H,1H2,(H,6,7) |
| InChIKey | CODYSRJDEULAFH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-oxo-1,3-oxathiolane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-1,3-oxathiolane-2-carboxylic acid?
The IUPAC name of 5-oxo-1,3-oxathiolane-2-carboxylic acid (CID 15168211) is 5-oxo-1,3-oxathiolane-2-carboxylic acid.
What is the SMILES notation for 5-oxo-1,3-oxathiolane-2-carboxylic acid?
The canonical SMILES for 5-oxo-1,3-oxathiolane-2-carboxylic acid is O=C1CSC(C(=O)O)O1.
What is the InChIKey of 5-oxo-1,3-oxathiolane-2-carboxylic acid?
The InChIKey is CODYSRJDEULAFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O4S/c5-2-1-9-4(8-2)3(6)7/h4H,1H2,(H,6,7).
What are the key properties of 5-oxo-1,3-oxathiolane-2-carboxylic acid?
5-oxo-1,3-oxathiolane-2-carboxylic acid has a molecular weight of 148.14 g/mol, XLogP of -0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1,3-oxathiolane-2-carboxylic acid is sourced from PubChem (CID 15168211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).