About N'-(2,2-dimethoxyethyl)pentanediamide
N'-(2,2-dimethoxyethyl)pentanediamide (PubChem CID 151683220) has the molecular formula C9H18N2O4
and a molecular weight of 218.25 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)pentanediamide.
Molecular Properties
| Compound Name | N'-(2,2-dimethoxyethyl)pentanediamide |
| PubChem CID | 151683220 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)pentanediamide |
| SMILES | COC(CNC(=O)CCCC(N)=O)OC |
| InChI | InChI=1S/C9H18N2O4/c1-14-9(15-2)6-11-8(13)5-3-4-7(10)12/h9H,3-6H2,1-2H3,(H2,10,12)(H,11,13) |
| InChIKey | RAZASLLYTZWGFK-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,2-dimethoxyethyl)pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-dimethoxyethyl)pentanediamide?
The IUPAC name of N'-(2,2-dimethoxyethyl)pentanediamide (CID 151683220) is N'-(2,2-dimethoxyethyl)pentanediamide.
What is the SMILES notation for N'-(2,2-dimethoxyethyl)pentanediamide?
The canonical SMILES for N'-(2,2-dimethoxyethyl)pentanediamide is COC(CNC(=O)CCCC(N)=O)OC.
What is the InChIKey of N'-(2,2-dimethoxyethyl)pentanediamide?
The InChIKey is RAZASLLYTZWGFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O4/c1-14-9(15-2)6-11-8(13)5-3-4-7(10)12/h9H,3-6H2,1-2H3,(H2,10,12)(H,11,13).
What are the key properties of N'-(2,2-dimethoxyethyl)pentanediamide?
N'-(2,2-dimethoxyethyl)pentanediamide has a molecular weight of 218.25 g/mol, XLogP of -0.62, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-dimethoxyethyl)pentanediamide is sourced from PubChem (CID 151683220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).