About 5,6-dihydropyrrolo[3,2-c]azocin-4-one
5,6-dihydropyrrolo[3,2-c]azocin-4-one (PubChem CID 151683622) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 5,6-dihydropyrrolo[3,2-c]azocin-4-one.
Molecular Properties
| Compound Name | 5,6-dihydropyrrolo[3,2-c]azocin-4-one |
| PubChem CID | 151683622 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 5,6-dihydropyrrolo[3,2-c]azocin-4-one |
| SMILES | O=C1NCC=CC=C2N=CC=C12 |
| InChI | InChI=1S/C9H8N2O/c12-9-7-4-6-10-8(7)3-1-2-5-11-9/h1-4,6H,5H2,(H,11,12) |
| InChIKey | RBBJALAGFOUIEH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydropyrrolo[3,2-c]azocin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydropyrrolo[3,2-c]azocin-4-one?
The IUPAC name of 5,6-dihydropyrrolo[3,2-c]azocin-4-one (CID 151683622) is 5,6-dihydropyrrolo[3,2-c]azocin-4-one.
What is the SMILES notation for 5,6-dihydropyrrolo[3,2-c]azocin-4-one?
The canonical SMILES for 5,6-dihydropyrrolo[3,2-c]azocin-4-one is O=C1NCC=CC=C2N=CC=C12.
What is the InChIKey of 5,6-dihydropyrrolo[3,2-c]azocin-4-one?
The InChIKey is RBBJALAGFOUIEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c12-9-7-4-6-10-8(7)3-1-2-5-11-9/h1-4,6H,5H2,(H,11,12).
What are the key properties of 5,6-dihydropyrrolo[3,2-c]azocin-4-one?
5,6-dihydropyrrolo[3,2-c]azocin-4-one has a molecular weight of 160.18 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydropyrrolo[3,2-c]azocin-4-one is sourced from PubChem (CID 151683622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).