About undecan-5-yl 1H-indole-3-carboxylate
undecan-5-yl 1H-indole-3-carboxylate (PubChem CID 151684250) has the molecular formula C20H29NO2
and a molecular weight of 315.46 g/mol. Its IUPAC name is undecan-5-yl 1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | undecan-5-yl 1H-indole-3-carboxylate |
| PubChem CID | 151684250 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | undecan-5-yl 1H-indole-3-carboxylate |
| SMILES | CCCCCCC(CCCC)OC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H29NO2/c1-3-5-7-8-12-16(11-6-4-2)23-20(22)18-15-21-19-14-10-9-13-17(18)19/h9-10,13-16,21H,3-8,11-12H2,1-2H3 |
| InChIKey | RBERHKBSGIDFFD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecan-5-yl 1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-5-yl 1H-indole-3-carboxylate?
The IUPAC name of undecan-5-yl 1H-indole-3-carboxylate (CID 151684250) is undecan-5-yl 1H-indole-3-carboxylate.
What is the SMILES notation for undecan-5-yl 1H-indole-3-carboxylate?
The canonical SMILES for undecan-5-yl 1H-indole-3-carboxylate is CCCCCCC(CCCC)OC(=O)c1c[nH]c2ccccc12.
What is the InChIKey of undecan-5-yl 1H-indole-3-carboxylate?
The InChIKey is RBERHKBSGIDFFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO2/c1-3-5-7-8-12-16(11-6-4-2)23-20(22)18-15-21-19-14-10-9-13-17(18)19/h9-10,13-16,21H,3-8,11-12H2,1-2H3.
What are the key properties of undecan-5-yl 1H-indole-3-carboxylate?
undecan-5-yl 1H-indole-3-carboxylate has a molecular weight of 315.46 g/mol, XLogP of 5.85, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-5-yl 1H-indole-3-carboxylate is sourced from PubChem (CID 151684250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).