C27H31BClF3N2O5 — CID 151684276
2-[(2R)-4-[2-chloro-4-(trifluoromethyl)benzoyl]-2-ethylpiperazin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 151684276) has the molecular formula C27H31BClF3N2O5 and a molecular weight of 566.81 g/mol. Its IUPAC name is 2-[(2R)-4-[2-chloro-4-(trifluoromethyl)benzoyl]-2-ethylpiperazin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 2-[(2R)-4-[2-chloro-4-(trifluoromethyl)benzoyl]-2-ethylpiperazin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 151684276 |
| Molecular Formula | C27H31BClF3N2O5 |
| Molecular Weight | 566.81 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 2-[(2R)-4-[2-chloro-4-(trifluoromethyl)benzoyl]-2-ethylpiperazin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CC[C@@H]1CN(C(=O)c2ccc(C(F)(F)F)cc2Cl)CCN1c1ccc(B2OC(C)(C)C(C)(C)O2)cc1C(=O)O |
| InChI | InChI=1S/C27H31BClF3N2O5/c1-6-18-15-33(23(35)19-9-7-16(13-21(19)29)27(30,31)32)11-12-34(18)22-10-8-17(14-20(22)24(36)37)28-38-25(2,3)26(4,5)39-28/h7-10,13-14,18H,6,11-12,15H2,1-5H3,(H,36,37)/t18-/m1/s1 |
| InChIKey | RBEUDANXSCKBOH-GOSISDBHSA-N |
| XLogP | 5.10 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.81 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|