About 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid
1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid (PubChem CID 15168441) has the molecular formula C12H9Cl2NO4
and a molecular weight of 302.11 g/mol. Its IUPAC name is 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid |
| PubChem CID | 15168441 |
| Molecular Formula | C12H9Cl2NO4 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid |
| SMILES | CC(=O)N1c2cc(Cl)cc(Cl)c2C(=O)CC1C(=O)O |
| InChI | InChI=1S/C12H9Cl2NO4/c1-5(16)15-8-3-6(13)2-7(14)11(8)10(17)4-9(15)12(18)19/h2-3,9H,4H2,1H3,(H,18,19) |
| InChIKey | MJNPJPJXZZVLPB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid?
The IUPAC name of 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid (CID 15168441) is 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid.
What is the SMILES notation for 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid?
The canonical SMILES for 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid is CC(=O)N1c2cc(Cl)cc(Cl)c2C(=O)CC1C(=O)O.
What is the InChIKey of 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid?
The InChIKey is MJNPJPJXZZVLPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl2NO4/c1-5(16)15-8-3-6(13)2-7(14)11(8)10(17)4-9(15)12(18)19/h2-3,9H,4H2,1H3,(H,18,19).
What are the key properties of 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid?
1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid has a molecular weight of 302.11 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-5,7-dichloro-4-oxo-2,3-dihydroquinoline-2-carboxylic acid is sourced from PubChem (CID 15168441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).