C23H14Cl3NO3 — CID 151684802
(5E)-3-benzyl-5-[phenyl-(3,4,5-trichlorophenyl)methylidene]-1,3-oxazolidine-2,4-dione (PubChem CID 151684802) has the molecular formula C23H14Cl3NO3 and a molecular weight of 458.73 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[phenyl-(3,4,5-trichlorophenyl)methylidene]-1,3-oxazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[phenyl-(3,4,5-trichlorophenyl)methylidene]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 151684802 |
| Molecular Formula | C23H14Cl3NO3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | (5E)-3-benzyl-5-[phenyl-(3,4,5-trichlorophenyl)methylidene]-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1O/C(=C(\c2ccccc2)c2cc(Cl)c(Cl)c(Cl)c2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H14Cl3NO3/c24-17-11-16(12-18(25)20(17)26)19(15-9-5-2-6-10-15)21-22(28)27(23(29)30-21)13-14-7-3-1-4-8-14/h1-12H,13H2/b21-19+ |
| InChIKey | RBHLKKBDVLMCGT-XUTLUUPISA-N |
| XLogP | 6.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|