C27H34F3N7O3 — CID 151685853
(2S)-2-(pyrido[3,2-d]pyrimidin-4-ylamino)-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]butanoic acid (PubChem CID 151685853) has the molecular formula C27H34F3N7O3 and a molecular weight of 561.61 g/mol. Its IUPAC name is (2S)-2-(pyrido[3,2-d]pyrimidin-4-ylamino)-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]butanoic acid.
| Compound Name | (2S)-2-(pyrido[3,2-d]pyrimidin-4-ylamino)-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 151685853 |
| Molecular Formula | C27H34F3N7O3 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | (2S)-2-(pyrido[3,2-d]pyrimidin-4-ylamino)-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOCC(F)(F)F)Nc1ncnc2cccnc12 |
| InChI | InChI=1S/C27H34F3N7O3/c28-27(29,30)17-40-16-15-37(13-2-1-6-20-9-8-19-5-3-12-32-24(19)35-20)14-10-22(26(38)39)36-25-23-21(33-18-34-25)7-4-11-31-23/h4,7-9,11,18,22H,1-3,5-6,10,12-17H2,(H,32,35)(H,38,39)(H,33,34,36)/t22-/m0/s1 |
| InChIKey | RBNFUEGAMTYXGT-QFIPXVFZSA-N |
| XLogP | 3.94 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|