C16H32O2Si — CID 15168731
(1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol (PubChem CID 15168731) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol.
| Compound Name | (1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol |
|---|---|
| PubChem CID | 15168731 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C16H32O2Si/c1-15(2,3)19(5,6)18-13-8-7-11-16(4)12(13)9-10-14(16)17/h12-14,17H,7-11H2,1-6H3/t12-,13-,14-,16-/m0/s1 |
| InChIKey | AKKIUBNHWOQAEN-YXWQFLTLSA-N |
| XLogP | 4.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|