C22H26F2N4O3S — CID 151688229
3-amino-5-(2,6-difluorophenyl)-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]pentanamide (PubChem CID 151688229) has the molecular formula C22H26F2N4O3S and a molecular weight of 464.54 g/mol. Its IUPAC name is 3-amino-5-(2,6-difluorophenyl)-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]pentanamide.
| Compound Name | 3-amino-5-(2,6-difluorophenyl)-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]pentanamide |
|---|---|
| PubChem CID | 151688229 |
| Molecular Formula | C22H26F2N4O3S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 3-amino-5-(2,6-difluorophenyl)-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]pentanamide |
| SMILES | NC(CCc1c(F)cccc1F)CC(=O)NCCNCCc1ccc(O)c2[nH]c(=O)sc12 |
| InChI | InChI=1S/C22H26F2N4O3S/c23-16-2-1-3-17(24)15(16)6-5-14(25)12-19(30)27-11-10-26-9-8-13-4-7-18(29)20-21(13)32-22(31)28-20/h1-4,7,14,26,29H,5-6,8-12,25H2,(H,27,30)(H,28,31) |
| InChIKey | RBZQKSBPSUBRIA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|