C29H25F6N3O5S — CID 151690749
4-[(5-cyclohexyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-fluorobenzoic acid (PubChem CID 151690749) has the molecular formula C29H25F6N3O5S and a molecular weight of 641.59 g/mol. Its IUPAC name is 4-[(5-cyclohexyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-fluorobenzoic acid.
| Compound Name | 4-[(5-cyclohexyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 151690749 |
| Molecular Formula | C29H25F6N3O5S |
| Molecular Weight | 641.59 g/mol |
| Exact Mass | 641.14 |
| IUPAC Name | 4-[(5-cyclohexyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(C3CCCCC3)cn2)C(=O)[C@H]2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1F |
| InChI | InChI=1S/C29H25F6N3O5S/c30-20-12-18(8-9-19(20)29(40)41)37(14-17-7-6-16(13-36-17)15-4-2-1-3-5-15)28(39)21-10-11-38(21)44(42,43)27-25(34)23(32)22(31)24(33)26(27)35/h6-9,12-13,15,21H,1-5,10-11,14H2,(H,40,41)/t21-/m1/s1 |
| InChIKey | RCMUOXFCDPVCSI-OAQYLSRUSA-N |
| XLogP | 5.66 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|