C19H23F6NO3 — CID 151694204
5-[3-(diethoxymethyl)-1H-indol-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol (PubChem CID 151694204) has the molecular formula C19H23F6NO3 and a molecular weight of 427.39 g/mol. Its IUPAC name is 5-[3-(diethoxymethyl)-1H-indol-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol.
| Compound Name | 5-[3-(diethoxymethyl)-1H-indol-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol |
|---|---|
| PubChem CID | 151694204 |
| Molecular Formula | C19H23F6NO3 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 5-[3-(diethoxymethyl)-1H-indol-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol |
| SMILES | CCOC(OCC)c1c(CCCC(O)(C(F)(F)F)C(F)(F)F)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H23F6NO3/c1-3-28-16(29-4-2)15-12-8-5-6-9-13(12)26-14(15)10-7-11-17(27,18(20,21)22)19(23,24)25/h5-6,8-9,16,26-27H,3-4,7,10-11H2,1-2H3 |
| InChIKey | RDFABWJUVJWEJC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 54.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|