C13H22OSi — CID 15169451
[(1R,2R)-1-(cyclopenten-1-yl)-2-ethenylcyclopropyl]oxy-trimethylsilane (PubChem CID 15169451) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is [(1R,2R)-1-(cyclopenten-1-yl)-2-ethenylcyclopropyl]oxy-trimethylsilane.
| Compound Name | [(1R,2R)-1-(cyclopenten-1-yl)-2-ethenylcyclopropyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15169451 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | [(1R,2R)-1-(cyclopenten-1-yl)-2-ethenylcyclopropyl]oxy-trimethylsilane |
| SMILES | C=C[C@H]1C[C@]1(O[Si](C)(C)C)C1=CCCC1 |
| InChI | InChI=1S/C13H22OSi/c1-5-11-10-13(11,14-15(2,3)4)12-8-6-7-9-12/h5,8,11H,1,6-7,9-10H2,2-4H3/t11-,13+/m0/s1 |
| InChIKey | IBTCJDORLAQUBQ-WCQYABFASA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|