C8H6ClF2NO2 — CID 151695437
[2-(chloromethyl)-4,5-difluorophenyl] carbamate (PubChem CID 151695437) has the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. Its IUPAC name is [2-(chloromethyl)-4,5-difluorophenyl] carbamate.
| Compound Name | [2-(chloromethyl)-4,5-difluorophenyl] carbamate |
|---|---|
| PubChem CID | 151695437 |
| Molecular Formula | C8H6ClF2NO2 |
| Molecular Weight | 221.59 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | [2-(chloromethyl)-4,5-difluorophenyl] carbamate |
| SMILES | NC(=O)Oc1cc(F)c(F)cc1CCl |
| InChI | InChI=1S/C8H6ClF2NO2/c9-3-4-1-5(10)6(11)2-7(4)14-8(12)13/h1-2H,3H2,(H2,12,13) |
| InChIKey | RDLJYPALYRMXCR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|