About 7,7-dipropoxyhexadec-5-ene
7,7-dipropoxyhexadec-5-ene (PubChem CID 151695817) has the molecular formula C22H44O2
and a molecular weight of 340.59 g/mol. Its IUPAC name is 7,7-dipropoxyhexadec-5-ene.
Molecular Properties
| Compound Name | 7,7-dipropoxyhexadec-5-ene |
| PubChem CID | 151695817 |
| Molecular Formula | C22H44O2 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 340.33 |
| IUPAC Name | 7,7-dipropoxyhexadec-5-ene |
| SMILES | CCCCC=CC(CCCCCCCCC)(OCCC)OCCC |
| InChI | InChI=1S/C22H44O2/c1-5-9-11-13-14-15-17-19-22(23-20-7-3,24-21-8-4)18-16-12-10-6-2/h16,18H,5-15,17,19-21H2,1-4H3 |
| InChIKey | RDNLYKGMQOYKHV-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7,7-dipropoxyhexadec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dipropoxyhexadec-5-ene?
The IUPAC name of 7,7-dipropoxyhexadec-5-ene (CID 151695817) is 7,7-dipropoxyhexadec-5-ene.
What is the SMILES notation for 7,7-dipropoxyhexadec-5-ene?
The canonical SMILES for 7,7-dipropoxyhexadec-5-ene is CCCCC=CC(CCCCCCCCC)(OCCC)OCCC.
What is the InChIKey of 7,7-dipropoxyhexadec-5-ene?
The InChIKey is RDNLYKGMQOYKHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2/c1-5-9-11-13-14-15-17-19-22(23-20-7-3,24-21-8-4)18-16-12-10-6-2/h16,18H,5-15,17,19-21H2,1-4H3.
What are the key properties of 7,7-dipropoxyhexadec-5-ene?
7,7-dipropoxyhexadec-5-ene has a molecular weight of 340.59 g/mol, XLogP of 7.42, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dipropoxyhexadec-5-ene is sourced from PubChem (CID 151695817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).