C38H52N2O6 — CID 15169992
[1-[4-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycyclohex-2-en-1-yl]oxy-2,2,6,6-tetramethylpiperidin-4-yl] benzoate (PubChem CID 15169992) has the molecular formula C38H52N2O6 and a molecular weight of 632.84 g/mol. Its IUPAC name is [1-[4-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycyclohex-2-en-1-yl]oxy-2,2,6,6-tetramethylpiperidin-4-yl] benzoate.
| Compound Name | [1-[4-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycyclohex-2-en-1-yl]oxy-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 15169992 |
| Molecular Formula | C38H52N2O6 |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.38 |
| IUPAC Name | [1-[4-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycyclohex-2-en-1-yl]oxy-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)N1OC1C=CC(ON2C(C)(C)CC(OC(=O)c3ccccc3)CC2(C)C)CC1 |
| InChI | InChI=1S/C38H52N2O6/c1-35(2)23-31(43-33(41)27-15-11-9-12-16-27)24-36(3,4)39(35)45-29-19-21-30(22-20-29)46-40-37(5,6)25-32(26-38(40,7)8)44-34(42)28-17-13-10-14-18-28/h9-19,21,29-32H,20,22-26H2,1-8H3 |
| InChIKey | OASRVPPNHHQSDD-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|