C40H60N2O6 — CID 15169995
[1-[8-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate (PubChem CID 15169995) has the molecular formula C40H60N2O6 and a molecular weight of 664.93 g/mol. Its IUPAC name is [1-[8-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate.
| Compound Name | [1-[8-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 15169995 |
| Molecular Formula | C40H60N2O6 |
| Molecular Weight | 664.93 g/mol |
| Exact Mass | 664.45 |
| IUPAC Name | [1-[8-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)N1OCCCCCCCCON1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C40H60N2O6/c1-37(2)27-33(47-35(43)31-21-15-13-16-22-31)28-38(3,4)41(37)45-25-19-11-9-10-12-20-26-46-42-39(5,6)29-34(30-40(42,7)8)48-36(44)32-23-17-14-18-24-32/h13-18,21-24,33-34H,9-12,19-20,25-30H2,1-8H3 |
| InChIKey | RREZIFMBJCEDSC-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.93 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|