C26H52N2O4 — CID 15169996
1-[8-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 15169996) has the molecular formula C26H52N2O4 and a molecular weight of 456.71 g/mol. Its IUPAC name is 1-[8-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[8-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 15169996 |
| Molecular Formula | C26H52N2O4 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.39 |
| IUPAC Name | 1-[8-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1OCCCCCCCCON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C26H52N2O4/c1-23(2)17-21(29)18-24(3,4)27(23)31-15-13-11-9-10-12-14-16-32-28-25(5,6)19-22(30)20-26(28,7)8/h21-22,29-30H,9-20H2,1-8H3 |
| InChIKey | IETSYUFKHHMOJU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|