C25H50N2O4 — CID 15169998
1-[7-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyheptoxy]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 15169998) has the molecular formula C25H50N2O4 and a molecular weight of 442.69 g/mol. Its IUPAC name is 1-[7-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyheptoxy]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[7-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyheptoxy]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 15169998 |
| Molecular Formula | C25H50N2O4 |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | 1-[7-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyheptoxy]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1OCCCCCCCON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C25H50N2O4/c1-22(2)16-20(28)17-23(3,4)26(22)30-14-12-10-9-11-13-15-31-27-24(5,6)18-21(29)19-25(27,7)8/h20-21,28-29H,9-19H2,1-8H3 |
| InChIKey | IKCDHYBPEIVMMM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|