C24H46N2O4 — CID 15169999
1-[4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycyclohexyl]oxy-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 15169999) has the molecular formula C24H46N2O4 and a molecular weight of 426.64 g/mol. Its IUPAC name is 1-[4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycyclohexyl]oxy-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycyclohexyl]oxy-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 15169999 |
| Molecular Formula | C24H46N2O4 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | 1-[4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycyclohexyl]oxy-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1OC1CCC(ON2C(C)(C)CC(O)CC2(C)C)CC1 |
| InChI | InChI=1S/C24H46N2O4/c1-21(2)13-17(27)14-22(3,4)25(21)29-19-9-11-20(12-10-19)30-26-23(5,6)15-18(28)16-24(26,7)8/h17-20,27-28H,9-16H2,1-8H3 |
| InChIKey | WNTUEKWJBKDBRQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |