C33H46N2O6 — CID 15170012
[1-[(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxymethoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate (PubChem CID 15170012) has the molecular formula C33H46N2O6 and a molecular weight of 566.74 g/mol. Its IUPAC name is [1-[(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxymethoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate.
| Compound Name | [1-[(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxymethoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 15170012 |
| Molecular Formula | C33H46N2O6 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | [1-[(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxymethoxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)N1OCON1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C33H46N2O6/c1-30(2)19-26(40-28(36)24-15-11-9-12-16-24)20-31(3,4)34(30)38-23-39-35-32(5,6)21-27(22-33(35,7)8)41-29(37)25-17-13-10-14-18-25/h9-18,26-27H,19-23H2,1-8H3 |
| InChIKey | XLLGCGSYBIOMFD-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|