C35H50N2O6 — CID 15170019
[1-[2-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yloxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate (PubChem CID 15170019) has the molecular formula C35H50N2O6 and a molecular weight of 594.79 g/mol. Its IUPAC name is [1-[2-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yloxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate.
| Compound Name | [1-[2-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yloxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 15170019 |
| Molecular Formula | C35H50N2O6 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.37 |
| IUPAC Name | [1-[2-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yloxy]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
| SMILES | CC(C)(ON1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C)ON1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C35H50N2O6/c1-31(2)21-27(40-29(38)25-17-13-11-14-18-25)22-32(3,4)36(31)42-35(9,10)43-37-33(5,6)23-28(24-34(37,7)8)41-30(39)26-19-15-12-16-20-26/h11-20,27-28H,21-24H2,1-10H3 |
| InChIKey | DZTIAFASSPQSDM-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|