C20H28N2O3S — CID 151700854
3-amino-N-(1-deuterio-2-methylpropyl)-2-(2-hydroxy-4-phenylbutyl)benzenesulfonamide (PubChem CID 151700854) has the molecular formula C20H28N2O3S and a molecular weight of 377.53 g/mol. Its IUPAC name is 3-amino-N-(1-deuterio-2-methylpropyl)-2-(2-hydroxy-4-phenylbutyl)benzenesulfonamide.
| Compound Name | 3-amino-N-(1-deuterio-2-methylpropyl)-2-(2-hydroxy-4-phenylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 151700854 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 3-amino-N-(1-deuterio-2-methylpropyl)-2-(2-hydroxy-4-phenylbutyl)benzenesulfonamide |
| SMILES | [2H]C(NS(=O)(=O)c1cccc(N)c1CC(O)CCc1ccccc1)C(C)C |
| InChI | InChI=1S/C20H28N2O3S/c1-15(2)14-22-26(24,25)20-10-6-9-19(21)18(20)13-17(23)12-11-16-7-4-3-5-8-16/h3-10,15,17,22-23H,11-14,21H2,1-2H3/i14D |
| InChIKey | REOFKULNJOWTTA-FCFVPJCTSA-N |
| XLogP | 2.74 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|