About 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one
5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one (PubChem CID 151701748) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one |
| PubChem CID | 151701748 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one |
| SMILES | CC1=CC(=O)C(O)C(O)=C1 |
| InChI | InChI=1S/C7H8O3/c1-4-2-5(8)7(10)6(9)3-4/h2-3,7-8,10H,1H3 |
| InChIKey | RESYYPWLDIBPJD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one?
The IUPAC name of 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one (CID 151701748) is 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one is CC1=CC(=O)C(O)C(O)=C1.
What is the InChIKey of 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one?
The InChIKey is RESYYPWLDIBPJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-4-2-5(8)7(10)6(9)3-4/h2-3,7-8,10H,1H3.
What are the key properties of 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one?
5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one has a molecular weight of 140.14 g/mol, XLogP of 0.32, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydroxy-3-methylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 151701748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).