About 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol
2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol (PubChem CID 15170266) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol.
Molecular Properties
| Compound Name | 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol |
| PubChem CID | 15170266 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol |
| SMILES | CC(CO)(CO)NCc1ccc2oc3ccc4occc4c3c2c1 |
| InChI | InChI=1S/C19H19NO4/c1-19(10-21,11-22)20-9-12-2-3-16-14(8-12)18-13-6-7-23-15(13)4-5-17(18)24-16/h2-8,20-22H,9-11H2,1H3 |
| InChIKey | NHCDDPRZEZBFRG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol?
The IUPAC name of 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol (CID 15170266) is 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol.
What is the SMILES notation for 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol?
The canonical SMILES for 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol is CC(CO)(CO)NCc1ccc2oc3ccc4occc4c3c2c1.
What is the InChIKey of 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol?
The InChIKey is NHCDDPRZEZBFRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4/c1-19(10-21,11-22)20-9-12-2-3-16-14(8-12)18-13-6-7-23-15(13)4-5-17(18)24-16/h2-8,20-22H,9-11H2,1H3.
What are the key properties of 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol?
2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol has a molecular weight of 325.36 g/mol, XLogP of 3.17, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1]benzofuro[5,4-b][1]benzofuran-9-ylmethylamino)-2-methylpropane-1,3-diol is sourced from PubChem (CID 15170266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).