C17H23F5O4 — CID 151704166
2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decane-1,1,1-triol (PubChem CID 151704166) has the molecular formula C17H23F5O4 and a molecular weight of 386.36 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decane-1,1,1-triol.
| Compound Name | 2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decane-1,1,1-triol |
|---|---|
| PubChem CID | 151704166 |
| Molecular Formula | C17H23F5O4 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decane-1,1,1-triol |
| SMILES | CCCCCCCCC(COc1c(F)c(F)c(F)c(F)c1F)C(O)(O)O |
| InChI | InChI=1S/C17H23F5O4/c1-2-3-4-5-6-7-8-10(17(23,24)25)9-26-16-14(21)12(19)11(18)13(20)15(16)22/h10,23-25H,2-9H2,1H3 |
| InChIKey | RFFOPTYRWCGRRR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|