About 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole
2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole (PubChem CID 151704843) has the molecular formula C10H14FNOS
and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole |
| PubChem CID | 151704843 |
| Molecular Formula | C10H14FNOS |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole |
| SMILES | CC1CC(F)(c2nccs2)CC(C)O1 |
| InChI | InChI=1S/C10H14FNOS/c1-7-5-10(11,6-8(2)13-7)9-12-3-4-14-9/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | RFJCDMUMOYSDAA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole?
The IUPAC name of 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole (CID 151704843) is 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole.
What is the SMILES notation for 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole?
The canonical SMILES for 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole is CC1CC(F)(c2nccs2)CC(C)O1.
What is the InChIKey of 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole?
The InChIKey is RFJCDMUMOYSDAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FNOS/c1-7-5-10(11,6-8(2)13-7)9-12-3-4-14-9/h3-4,7-8H,5-6H2,1-2H3.
What are the key properties of 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole?
2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole has a molecular weight of 215.29 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-2,6-dimethyloxan-4-yl)-1,3-thiazole is sourced from PubChem (CID 151704843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).