About 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone
1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone (PubChem CID 151705279) has the molecular formula C16H15BrFN3OS
and a molecular weight of 396.29 g/mol. Its IUPAC name is 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone |
| PubChem CID | 151705279 |
| Molecular Formula | C16H15BrFN3OS |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone |
| SMILES | CC(=O)N1CCC2(C1)CN(c1ncc(F)s1)c1ccc(Br)cc12 |
| InChI | InChI=1S/C16H15BrFN3OS/c1-10(22)20-5-4-16(8-20)9-21(15-19-7-14(18)23-15)13-3-2-11(17)6-12(13)16/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | RFLGAKNMNGBBBZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone?
The IUPAC name of 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone (CID 151705279) is 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone.
What is the SMILES notation for 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone?
The canonical SMILES for 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone is CC(=O)N1CCC2(C1)CN(c1ncc(F)s1)c1ccc(Br)cc12.
What is the InChIKey of 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone?
The InChIKey is RFLGAKNMNGBBBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrFN3OS/c1-10(22)20-5-4-16(8-20)9-21(15-19-7-14(18)23-15)13-3-2-11(17)6-12(13)16/h2-3,6-7H,4-5,8-9H2,1H3.
What are the key properties of 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone?
1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone has a molecular weight of 396.29 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-bromo-1-(5-fluoro-1,3-thiazol-2-yl)spiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone is sourced from PubChem (CID 151705279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).