C21H37O3P — CID 15170600
2-[(1E,3E)-5-di(propan-2-yloxy)phosphoryl-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene (PubChem CID 15170600) has the molecular formula C21H37O3P and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[(1E,3E)-5-di(propan-2-yloxy)phosphoryl-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E)-5-di(propan-2-yloxy)phosphoryl-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 15170600 |
| Molecular Formula | C21H37O3P |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 2-[(1E,3E)-5-di(propan-2-yloxy)phosphoryl-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/CP(=O)(OC(C)C)OC(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H37O3P/c1-16(2)23-25(22,24-17(3)4)15-13-18(5)11-12-20-19(6)10-9-14-21(20,7)8/h11-13,16-17H,9-10,14-15H2,1-8H3/b12-11+,18-13+ |
| InChIKey | MEZJGSFVGMWHGT-RZMWGWOTSA-N |
| XLogP | 7.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|