C30H38F3N5O5SSi — CID 151713498
[(1R,2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl] methanesulfonate (PubChem CID 151713498) has the molecular formula C30H38F3N5O5SSi and a molecular weight of 665.81 g/mol. Its IUPAC name is [(1R,2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl] methanesulfonate.
| Compound Name | [(1R,2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl] methanesulfonate |
|---|---|
| PubChem CID | 151713498 |
| Molecular Formula | C30H38F3N5O5SSi |
| Molecular Weight | 665.81 g/mol |
| Exact Mass | 665.23 |
| IUPAC Name | [(1R,2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl] methanesulfonate |
| SMILES | Cc1noc(C)c1-c1ccc2c(-c3nc(N[C@H]4CCC[C@H]4OS(C)(=O)=O)ncc3C(F)(F)F)cn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C30H38F3N5O5SSi/c1-18-27(19(2)42-37-18)20-10-11-21-22(16-38(25(21)14-20)17-41-12-13-45(4,5)6)28-23(30(31,32)33)15-34-29(36-28)35-24-8-7-9-26(24)43-44(3,39)40/h10-11,14-16,24,26H,7-9,12-13,17H2,1-6H3,(H,34,35,36)/t24-,26+/m0/s1 |
| InChIKey | RHAXFQYRFXDOAJ-AZGAKELHSA-N |
| XLogP | 7.01 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.81 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|