C14H10F2N4O4S — CID 151713814
(3S)-7-[(5-cyano-3-pyridinyl)oxy]-2,2-difluoro-3-hydroxy-1,3-dihydroindole-4-sulfonamide (PubChem CID 151713814) has the molecular formula C14H10F2N4O4S and a molecular weight of 368.32 g/mol. Its IUPAC name is (3S)-7-[(5-cyano-3-pyridinyl)oxy]-2,2-difluoro-3-hydroxy-1,3-dihydroindole-4-sulfonamide.
| Compound Name | (3S)-7-[(5-cyano-3-pyridinyl)oxy]-2,2-difluoro-3-hydroxy-1,3-dihydroindole-4-sulfonamide |
|---|---|
| PubChem CID | 151713814 |
| Molecular Formula | C14H10F2N4O4S |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (3S)-7-[(5-cyano-3-pyridinyl)oxy]-2,2-difluoro-3-hydroxy-1,3-dihydroindole-4-sulfonamide |
| SMILES | N#Cc1cncc(Oc2ccc(S(N)(=O)=O)c3c2NC(F)(F)[C@H]3O)c1 |
| InChI | InChI=1S/C14H10F2N4O4S/c15-14(16)13(21)11-10(25(18,22)23)2-1-9(12(11)20-14)24-8-3-7(4-17)5-19-6-8/h1-3,5-6,13,20-21H,(H2,18,22,23)/t13-/m0/s1 |
| InChIKey | RHCNDKSQEPGXRW-ZDUSSCGKSA-N |
| XLogP | 1.44 |
| TPSA | 138.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|