About 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol
2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol (PubChem CID 151716442) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol |
| PubChem CID | 151716442 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol |
| SMILES | CC(C)(C)NC1=C(O)C(C)(NC(C)(C)C)CC=C1 |
| InChI | InChI=1S/C15H28N2O/c1-13(2,3)16-11-9-8-10-15(7,12(11)18)17-14(4,5)6/h8-9,16-18H,10H2,1-7H3 |
| InChIKey | RHQYTNDBQMLPLW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol (CID 151716442) is 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol is CC(C)(C)NC1=C(O)C(C)(NC(C)(C)C)CC=C1.
What is the InChIKey of 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol?
The InChIKey is RHQYTNDBQMLPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c1-13(2,3)16-11-9-8-10-15(7,12(11)18)17-14(4,5)6/h8-9,16-18H,10H2,1-7H3.
What are the key properties of 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol?
2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol has a molecular weight of 252.40 g/mol, XLogP of 3.25, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(tert-butylamino)-6-methylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 151716442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).