C16H23ClN2O4 — CID 151717909
tert-butyl N-[(2S)-1-[(5-chloro-2-hydroxy-3-methylphenyl)methylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 151717909) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(5-chloro-2-hydroxy-3-methylphenyl)methylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(5-chloro-2-hydroxy-3-methylphenyl)methylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 151717909 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(5-chloro-2-hydroxy-3-methylphenyl)methylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1cc(Cl)cc(CNC(=O)[C@H](C)NC(=O)OC(C)(C)C)c1O |
| InChI | InChI=1S/C16H23ClN2O4/c1-9-6-12(17)7-11(13(9)20)8-18-14(21)10(2)19-15(22)23-16(3,4)5/h6-7,10,20H,8H2,1-5H3,(H,18,21)(H,19,22)/t10-/m0/s1 |
| InChIKey | RHYHJVYJZJGXNI-JTQLQIEISA-N |
| XLogP | 2.88 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|