C24H23NO2S — CID 15171831
2,5,7,8-tetramethyl-2-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]-3,4-dihydrochromen-6-ol (PubChem CID 15171831) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is 2,5,7,8-tetramethyl-2-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]-3,4-dihydrochromen-6-ol.
| Compound Name | 2,5,7,8-tetramethyl-2-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 15171831 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2,5,7,8-tetramethyl-2-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C#Cc1ccc(-c3ccccn3)s1)O2 |
| InChI | InChI=1S/C24H23NO2S/c1-15-16(2)23-19(17(3)22(15)26)11-13-24(4,27-23)12-10-18-8-9-21(28-18)20-7-5-6-14-25-20/h5-9,14,26H,11,13H2,1-4H3 |
| InChIKey | GRDRVWOCLGYQNB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|