C24H23NO2 — CID 15171846
2-(2-isoquinolin-4-ylethynyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol (PubChem CID 15171846) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-(2-isoquinolin-4-ylethynyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 2-(2-isoquinolin-4-ylethynyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 15171846 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-(2-isoquinolin-4-ylethynyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C#Cc1cncc3ccccc13)O2 |
| InChI | InChI=1S/C24H23NO2/c1-15-16(2)23-20(17(3)22(15)26)10-12-24(4,27-23)11-9-19-14-25-13-18-7-5-6-8-21(18)19/h5-8,13-14,26H,10,12H2,1-4H3 |
| InChIKey | GAAMHBXBQOYLEI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|