C20H30NO7P — CID 15171954
diethyl 6-(diethoxyphosphorylmethyl)-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate (PubChem CID 15171954) has the molecular formula C20H30NO7P and a molecular weight of 427.43 g/mol. Its IUPAC name is diethyl 6-(diethoxyphosphorylmethyl)-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate.
| Compound Name | diethyl 6-(diethoxyphosphorylmethyl)-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 15171954 |
| Molecular Formula | C20H30NO7P |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | diethyl 6-(diethoxyphosphorylmethyl)-3,4-dihydro-1H-isoquinoline-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1c2ccc(CP(=O)(OCC)OCC)cc2CCN1C(=O)OCC |
| InChI | InChI=1S/C20H30NO7P/c1-5-25-19(22)18-17-10-9-15(14-29(24,27-7-3)28-8-4)13-16(17)11-12-21(18)20(23)26-6-2/h9-10,13,18H,5-8,11-12,14H2,1-4H3 |
| InChIKey | KQBOJEGPYVDONV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|