C12H16NO5P — CID 15171969
5-(2-phosphonoethyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (PubChem CID 15171969) has the molecular formula C12H16NO5P and a molecular weight of 285.24 g/mol. Its IUPAC name is 5-(2-phosphonoethyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.
| Compound Name | 5-(2-phosphonoethyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 15171969 |
| Molecular Formula | C12H16NO5P |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 5-(2-phosphonoethyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2c(CCP(=O)(O)O)cccc2CN1 |
| InChI | InChI=1S/C12H16NO5P/c14-12(15)11-6-10-8(4-5-19(16,17)18)2-1-3-9(10)7-13-11/h1-3,11,13H,4-7H2,(H,14,15)(H2,16,17,18) |
| InChIKey | UWMGGKFMOJLPMT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|