About cyclopentane-1,1-dicarbonitrile
cyclopentane-1,1-dicarbonitrile (PubChem CID 15172035) has the molecular formula C7H8N2
and a molecular weight of 120.16 g/mol. Its IUPAC name is cyclopentane-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | cyclopentane-1,1-dicarbonitrile |
| PubChem CID | 15172035 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.16 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | cyclopentane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)CCCC1 |
| InChI | InChI=1S/C7H8N2/c8-5-7(6-9)3-1-2-4-7/h1-4H2 |
| InChIKey | VIONVMHMAKDDDM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentane-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane-1,1-dicarbonitrile?
The IUPAC name of cyclopentane-1,1-dicarbonitrile (CID 15172035) is cyclopentane-1,1-dicarbonitrile.
What is the SMILES notation for cyclopentane-1,1-dicarbonitrile?
The canonical SMILES for cyclopentane-1,1-dicarbonitrile is N#CC1(C#N)CCCC1.
What is the InChIKey of cyclopentane-1,1-dicarbonitrile?
The InChIKey is VIONVMHMAKDDDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c8-5-7(6-9)3-1-2-4-7/h1-4H2.
What are the key properties of cyclopentane-1,1-dicarbonitrile?
cyclopentane-1,1-dicarbonitrile has a molecular weight of 120.16 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane-1,1-dicarbonitrile is sourced from PubChem (CID 15172035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).