About 1H-triazolo[5,1-c][1,4]benzodiazepine
1H-triazolo[5,1-c][1,4]benzodiazepine (PubChem CID 151730018) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is 1H-triazolo[5,1-c][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 1H-triazolo[5,1-c][1,4]benzodiazepine |
| PubChem CID | 151730018 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1H-triazolo[5,1-c][1,4]benzodiazepine |
| SMILES | C1=NNN2C=c3ccccc3=NC=C12 |
| InChI | InChI=1S/C10H8N4/c1-2-4-10-8(3-1)7-14-9(5-11-10)6-12-13-14/h1-7,13H |
| InChIKey | RKJGFHGUMFXDDX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-triazolo[5,1-c][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-triazolo[5,1-c][1,4]benzodiazepine?
The IUPAC name of 1H-triazolo[5,1-c][1,4]benzodiazepine (CID 151730018) is 1H-triazolo[5,1-c][1,4]benzodiazepine.
What is the SMILES notation for 1H-triazolo[5,1-c][1,4]benzodiazepine?
The canonical SMILES for 1H-triazolo[5,1-c][1,4]benzodiazepine is C1=NNN2C=c3ccccc3=NC=C12.
What is the InChIKey of 1H-triazolo[5,1-c][1,4]benzodiazepine?
The InChIKey is RKJGFHGUMFXDDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4/c1-2-4-10-8(3-1)7-14-9(5-11-10)6-12-13-14/h1-7,13H.
What are the key properties of 1H-triazolo[5,1-c][1,4]benzodiazepine?
1H-triazolo[5,1-c][1,4]benzodiazepine has a molecular weight of 184.20 g/mol, XLogP of -0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-triazolo[5,1-c][1,4]benzodiazepine is sourced from PubChem (CID 151730018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).